C19H25N2O9P — CID 139366455
ethyl 5-[[(2S,6R,7R,7aS)-6-(2,4-dioxopyrimidin-1-yl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate (PubChem CID 139366455) has the molecular formula C19H25N2O9P and a molecular weight of 456.39 g/mol. Its IUPAC name is ethyl 5-[[(2S,6R,7R,7aS)-6-(2,4-dioxopyrimidin-1-yl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate.
| Compound Name | ethyl 5-[[(2S,6R,7R,7aS)-6-(2,4-dioxopyrimidin-1-yl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate |
|---|---|
| PubChem CID | 139366455 |
| Molecular Formula | C19H25N2O9P |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | ethyl 5-[[(2S,6R,7R,7aS)-6-(2,4-dioxopyrimidin-1-yl)-7-ethynyl-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]pentanoate |
| SMILES | C#C[C@]1(C)[C@@H]2O[P@@](=O)(OCCCCC(=O)OCC)OCC2O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C19H25N2O9P/c1-4-19(3)16-13(29-17(19)21-10-9-14(22)20-18(21)24)12-28-31(25,30-16)27-11-7-6-8-15(23)26-5-2/h1,9-10,13,16-17H,5-8,11-12H2,2-3H3,(H,20,22,24)/t13?,16-,17-,19-,31+/m1/s1 |
| InChIKey | CTHMBBQKPHOIES-AVYUJSANSA-N |
| XLogP | 1.35 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|