C10H14N2O5S — CID 167690170
1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 167690170) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 167690170 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-5-methyloxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | C[C@]1(CO)O[C@@H](n2ccc(=S)[nH]c2=O)[C@@H](O)C1O |
| InChI | InChI=1S/C10H14N2O5S/c1-10(4-13)7(15)6(14)8(17-10)12-3-2-5(18)11-9(12)16/h2-3,6-8,13-15H,4H2,1H3,(H,11,16,18)/t6-,7?,8+,10+/m0/s1 |
| InChIKey | NJQPHXQYJQTTBF-JIDVSUIFSA-N |
| XLogP | -1.09 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|