C10H11FN2O3 — CID 10846846
5-fluoro-1-(2-oxocyclohexyl)pyrimidine-2,4-dione (PubChem CID 10846846) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is 5-fluoro-1-(2-oxocyclohexyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(2-oxocyclohexyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10846846 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-fluoro-1-(2-oxocyclohexyl)pyrimidine-2,4-dione |
| SMILES | O=C1CCCCC1n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11FN2O3/c11-6-5-13(10(16)12-9(6)15)7-3-1-2-4-8(7)14/h5,7H,1-4H2,(H,12,15,16) |
| InChIKey | VOSUNXYJUNRTOY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |