C9H7FN2O4 — CID 52916693
5-fluoro-1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione (PubChem CID 52916693) has the molecular formula C9H7FN2O4 and a molecular weight of 226.16 g/mol. Its IUPAC name is 5-fluoro-1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 52916693 |
| Molecular Formula | C9H7FN2O4 |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 5-fluoro-1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione |
| SMILES | O=C1C=CCO[C@@H]1n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H7FN2O4/c10-5-4-12(9(15)11-7(5)14)8-6(13)2-1-3-16-8/h1-2,4,8H,3H2,(H,11,14,15)/t8-/m0/s1 |
| InChIKey | SEVHTONQYXGODI-QMMMGPOBSA-N |
| XLogP | -0.67 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |