C9H8F2N2O4 — CID 169190520
4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde (PubChem CID 169190520) has the molecular formula C9H8F2N2O4 and a molecular weight of 246.17 g/mol. Its IUPAC name is 4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde.
| Compound Name | 4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 169190520 |
| Molecular Formula | C9H8F2N2O4 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
| SMILES | O=CC1CC(F)C(n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H8F2N2O4/c10-5-1-4(3-14)17-8(5)13-2-6(11)7(15)12-9(13)16/h2-5,8H,1H2,(H,12,15,16) |
| InChIKey | UOORHMFPOKYSFK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|