C9H8ClFN2O4 — CID 170218498
(2S,4S,5R)-4-chloro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde (PubChem CID 170218498) has the molecular formula C9H8ClFN2O4 and a molecular weight of 262.62 g/mol. Its IUPAC name is (2S,4S,5R)-4-chloro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde.
| Compound Name | (2S,4S,5R)-4-chloro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 170218498 |
| Molecular Formula | C9H8ClFN2O4 |
| Molecular Weight | 262.62 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (2S,4S,5R)-4-chloro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolane-2-carbaldehyde |
| SMILES | O=C[C@@H]1C[C@H](Cl)[C@H](n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H8ClFN2O4/c10-5-1-4(3-14)17-8(5)13-2-6(11)7(15)12-9(13)16/h2-5,8H,1H2,(H,12,15,16)/t4-,5-,8+/m0/s1 |
| InChIKey | HCOQKCJLRLHAEO-ZVQZEWSASA-N |
| XLogP | -0.23 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.62 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|