C9H8N2O4 — CID 52916692
1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione (PubChem CID 52916692) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 52916692 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-[(6S)-5-oxo-2H-pyran-6-yl]pyrimidine-2,4-dione |
| SMILES | O=C1C=CCO[C@@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H8N2O4/c12-6-2-1-5-15-8(6)11-4-3-7(13)10-9(11)14/h1-4,8H,5H2,(H,10,13,14)/t8-/m0/s1 |
| InChIKey | UXTHBMGNTVVSRG-QMMMGPOBSA-N |
| XLogP | -0.81 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |