C10H11FN2O4 — CID 10354357
1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10354357) has the molecular formula C10H11FN2O4 and a molecular weight of 242.21 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10354357 |
| Molecular Formula | C10H11FN2O4 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)-3-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C1[C@H](n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@H]1F |
| InChI | InChI=1S/C10H11FN2O4/c1-5-8(11)6(4-14)17-9(5)13-3-2-7(15)12-10(13)16/h2-3,6,8-9,14H,1,4H2,(H,12,15,16)/t6-,8+,9-/m1/s1 |
| InChIKey | KPRBBVVGUJEGRJ-BWVDBABLSA-N |
| XLogP | -0.68 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|