C10H10F4N2O3S2 — CID 122450020
5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dithione (PubChem CID 122450020) has the molecular formula C10H10F4N2O3S2 and a molecular weight of 346.33 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dithione.
| Compound Name | 5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dithione |
|---|---|
| PubChem CID | 122450020 |
| Molecular Formula | C10H10F4N2O3S2 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 5-fluoro-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dithione |
| SMILES | OC[C@H]1O[C@@H](n2cc(F)c(=S)[nH]c2=S)C(C(F)(F)F)[C@H]1O |
| InChI | InChI=1S/C10H10F4N2O3S2/c11-3-1-16(9(21)15-7(3)20)8-5(10(12,13)14)6(18)4(2-17)19-8/h1,4-6,8,17-18H,2H2,(H,15,20,21)/t4-,5?,6+,8-/m1/s1 |
| InChIKey | VCVGDUXXDQADRA-TZLAVLDLSA-N |
| XLogP | 1.84 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|