C9H15B2FN2O10P2+2 — CID 171528845
CID 171528845 (PubChem CID 171528845) has the molecular formula C9H15B2FN2O10P2+2 and a molecular weight of 413.79 g/mol.
| Compound Name | CID 171528845 |
|---|---|
| PubChem CID | 171528845 |
| Molecular Formula | C9H15B2FN2O10P2+2 |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | — |
| SMILES | [B]CO[P+](O)(O)O[P+](O)(O)O.[B][C@@H]1CCC(n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C8H8BFN2O3.CH7BO7P2/c9-5-1-2-6(15-5)12-3-4(10)7(13)11-8(12)14;2-1-8-11(6,7)9-10(3,4)5/h3,5-6H,1-2H2,(H,11,13,14);3-7H,1H2/q;+2/t5-,6?;/m0./s1 |
| InChIKey | VCDVDKDZEXFESZ-GNVLWMSISA-N |
| XLogP | -2.06 |
| TPSA | 183.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|