C9H12B2ClN2O6P — CID 153342271
CID 153342271 (PubChem CID 153342271) has the molecular formula C9H12B2ClN2O6P and a molecular weight of 332.25 g/mol.
| Compound Name | CID 153342271 |
|---|---|
| PubChem CID | 153342271 |
| Molecular Formula | C9H12B2ClN2O6P |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | — |
| SMILES | [B]COP(O)O.[B][C@@H]1CCC(n2cc(Cl)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C8H8BClN2O3.CH4BO3P/c9-5-1-2-6(15-5)12-3-4(10)7(13)11-8(12)14;2-1-5-6(3)4/h3,5-6H,1-2H2,(H,11,13,14);3-4H,1H2/t5-,6?;/m0./s1 |
| InChIKey | NWKGSBXCJWYOGD-GNVLWMSISA-N |
| XLogP | -0.67 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|