C8H7ClN2O3 — CID 178018403
5-chloro-1-[(2S)-2,3-dihydrofuran-2-yl]pyrimidine-2,4-dione (PubChem CID 178018403) has the molecular formula C8H7ClN2O3 and a molecular weight of 214.61 g/mol. Its IUPAC name is 5-chloro-1-[(2S)-2,3-dihydrofuran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-chloro-1-[(2S)-2,3-dihydrofuran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 178018403 |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 5-chloro-1-[(2S)-2,3-dihydrofuran-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2CC=CO2)cc1Cl |
| InChI | InChI=1S/C8H7ClN2O3/c9-5-4-11(6-2-1-3-14-6)8(13)10-7(5)12/h1,3-4,6H,2H2,(H,10,12,13)/t6-/m0/s1 |
| InChIKey | VCKFJTOQSYIMHQ-LURJTMIESA-N |
| XLogP | 0.62 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |