C9H11F2N2O6PS — CID 171528820
[(2R,5R)-2-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 171528820) has the molecular formula C9H11F2N2O6PS and a molecular weight of 344.23 g/mol. Its IUPAC name is [(2R,5R)-2-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-2-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 171528820 |
| Molecular Formula | C9H11F2N2O6PS |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | [(2R,5R)-2-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(=S)n([C@H]2CC[C@@](F)(COP(=O)(O)O)O2)cc1F |
| InChI | InChI=1S/C9H11F2N2O6PS/c10-5-3-13(8(21)12-7(5)14)6-1-2-9(11,19-6)4-18-20(15,16)17/h3,6H,1-2,4H2,(H,12,14,21)(H2,15,16,17)/t6-,9+/m1/s1 |
| InChIKey | HYQJKHYQUSHBJW-MUWHJKNJSA-N |
| XLogP | 1.13 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|