C20H25ClN2O8PS+ — CID 153342169
(6-chloro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethanol;ethane;5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one (PubChem CID 153342169) has the molecular formula C20H25ClN2O8PS+ and a molecular weight of 519.92 g/mol. Its IUPAC name is (6-chloro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethanol;ethane;5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one.
| Compound Name | (6-chloro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethanol;ethane;5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 153342169 |
| Molecular Formula | C20H25ClN2O8PS+ |
| Molecular Weight | 519.92 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | (6-chloro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethanol;ethane;5-ethynyl-1-[(5S)-5-hydroxyoxolan-2-yl]-4-sulfanylidenepyrimidin-2-one |
| SMILES | C#Cc1cn(C2CC[C@@H](O)O2)c(=O)[nH]c1=S.CC.OCO[P+]1(O)OCc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C10H10N2O3S.C8H9ClO5P.C2H6/c1-2-6-5-12(10(14)11-9(6)16)7-3-4-8(13)15-7;9-7-1-2-8-6(3-7)4-12-15(11,14-8)13-5-10;1-2/h1,5,7-8,13H,3-4H2,(H,11,14,16);1-3,10-11H,4-5H2;1-2H3/q;+1;/t7?,8-;;/m0../s1 |
| InChIKey | CZFUHVYRYPPZMG-AEUOCKLGSA-N |
| XLogP | 3.43 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.92 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|