C16H17ClN2O6PS+ — CID 153342035
5-chloro-1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 153342035) has the molecular formula C16H17ClN2O6PS+ and a molecular weight of 431.81 g/mol. Its IUPAC name is 5-chloro-1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-chloro-1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 153342035 |
| Molecular Formula | C16H17ClN2O6PS+ |
| Molecular Weight | 431.81 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 5-chloro-1-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(C2CCC(CO[P+]3(O)OCc4ccccc4O3)O2)cc1Cl |
| InChI | InChI=1S/C16H16ClN2O6PS/c17-12-7-19(16(27)18-15(12)20)14-6-5-11(24-14)9-23-26(21)22-8-10-3-1-2-4-13(10)25-26/h1-4,7,11,14,21H,5-6,8-9H2/p+1 |
| InChIKey | VRLFDDXEXUDUMR-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|