C18H21N5O6P+ — CID 164882292
9-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine (PubChem CID 164882292) has the molecular formula C18H21N5O6P+ and a molecular weight of 434.37 g/mol. Its IUPAC name is 9-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine.
| Compound Name | 9-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 164882292 |
| Molecular Formula | C18H21N5O6P+ |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 9-[5-[(2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2C1CCC(CO[P+]2(O)OCc3ccccc3O2)O1 |
| InChI | InChI=1S/C18H21N5O6P/c1-25-17-15-16(21-18(19)22-17)23(10-20-15)14-7-6-12(28-14)9-27-30(24)26-8-11-4-2-3-5-13(11)29-30/h2-5,10,12,14,24H,6-9H2,1H3,(H2,19,21,22)/q+1 |
| InChIKey | HFJNPETUKIMCIK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|