C20H21N6O7P — CID 90207207
(3R,4S,5R)-2-(2-amino-6-methoxypurin-9-yl)-4-hydroxy-3-methyl-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3-carbonitrile (PubChem CID 90207207) has the molecular formula C20H21N6O7P and a molecular weight of 488.40 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2-amino-6-methoxypurin-9-yl)-4-hydroxy-3-methyl-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3-carbonitrile.
| Compound Name | (3R,4S,5R)-2-(2-amino-6-methoxypurin-9-yl)-4-hydroxy-3-methyl-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 90207207 |
| Molecular Formula | C20H21N6O7P |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (3R,4S,5R)-2-(2-amino-6-methoxypurin-9-yl)-4-hydroxy-3-methyl-5-[(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolane-3-carbonitrile |
| SMILES | COc1nc(N)nc2c1ncn2C1O[C@H](COP2(=O)OCc3ccccc3O2)[C@@H](O)[C@@]1(C)C#N |
| InChI | InChI=1S/C20H21N6O7P/c1-20(9-21)15(27)13(8-31-34(28)30-7-11-5-3-4-6-12(11)33-34)32-18(20)26-10-23-14-16(26)24-19(22)25-17(14)29-2/h3-6,10,13,15,18,27H,7-8H2,1-2H3,(H2,22,24,25)/t13-,15-,18?,20-,34?/m1/s1 |
| InChIKey | PCQRKMTVUUFUAH-SZLVLLHQSA-N |
| XLogP | 1.94 |
| TPSA | 176.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|