C11H15N5O4 — CID 57250206
[(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxyoxolan-2-yl]methanol (PubChem CID 57250206) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxyoxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxyoxolan-2-yl]methanol |
|---|---|
| PubChem CID | 57250206 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | [(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxyoxolan-2-yl]methanol |
| SMILES | COc1nc(N)nc2c1ncn2O[C@@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C11H15N5O4/c1-18-10-8-9(14-11(12)15-10)16(5-13-8)20-7-3-2-6(4-17)19-7/h5-7,17H,2-4H2,1H3,(H2,12,14,15)/t6-,7+/m0/s1 |
| InChIKey | YPLRXMIEMCCMLA-NKWVEPMBSA-N |
| XLogP | -0.66 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |