C10H14N6O6 — CID 143758641
2-(2-amino-6-aminooxypurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 143758641) has the molecular formula C10H14N6O6 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(2-amino-6-aminooxypurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-(2-amino-6-aminooxypurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 143758641 |
| Molecular Formula | C10H14N6O6 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-(2-amino-6-aminooxypurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NOc1nc(N)nc2c1ncn2OC1OC(CO)C(O)C1O |
| InChI | InChI=1S/C10H14N6O6/c11-10-14-7-4(8(15-10)21-12)13-2-16(7)22-9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1,12H2,(H2,11,14,15) |
| InChIKey | HSVASFYSKKFBSM-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 184.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|