C16H16ClN5O5 — CID 121230672
(2S,3R,4S,5R)-2-(2-anilino-6-chloropurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 121230672) has the molecular formula C16H16ClN5O5 and a molecular weight of 393.79 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(2-anilino-6-chloropurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(2-anilino-6-chloropurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 121230672 |
| Molecular Formula | C16H16ClN5O5 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (2S,3R,4S,5R)-2-(2-anilino-6-chloropurin-9-yl)oxy-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](On2cnc3c(Cl)nc(Nc4ccccc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H16ClN5O5/c17-13-10-14(21-16(20-13)19-8-4-2-1-3-5-8)22(7-18-10)27-15-12(25)11(24)9(6-23)26-15/h1-5,7,9,11-12,15,23-25H,6H2,(H,19,20,21)/t9-,11-,12-,15+/m1/s1 |
| InChIKey | CDCNHNQQQFODLQ-CGEWXTDFSA-N |
| XLogP | 0.09 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |