C17H18N5O4P — CID 144900469
9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]purin-6-amine (PubChem CID 144900469) has the molecular formula C17H18N5O4P and a molecular weight of 387.34 g/mol. Its IUPAC name is 9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 144900469 |
| Molecular Formula | C17H18N5O4P |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1CCC(COP2OCc3ccccc3O2)O1 |
| InChI | InChI=1S/C17H18N5O4P/c18-16-15-17(20-9-19-16)22(10-21-15)14-6-5-12(25-14)8-24-27-23-7-11-3-1-2-4-13(11)26-27/h1-4,9-10,12,14H,5-8H2,(H2,18,19,20) |
| InChIKey | BGZWXRXFQSDFOC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|