C18H18F2N5O4P — CID 144900497
9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-5-(difluoromethyl)oxolan-2-yl]purin-6-amine (PubChem CID 144900497) has the molecular formula C18H18F2N5O4P and a molecular weight of 437.34 g/mol. Its IUPAC name is 9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-5-(difluoromethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-5-(difluoromethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 144900497 |
| Molecular Formula | C18H18F2N5O4P |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 9-[5-(4H-1,3,2-benzodioxaphosphinin-2-yloxymethyl)-5-(difluoromethyl)oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1CCC(COP2OCc3ccccc3O2)(C(F)F)O1 |
| InChI | InChI=1S/C18H18F2N5O4P/c19-17(20)18(8-27-30-26-7-11-3-1-2-4-12(11)29-30)6-5-13(28-18)25-10-24-14-15(21)22-9-23-16(14)25/h1-4,9-10,13,17H,5-8H2,(H2,21,22,23) |
| InChIKey | LJLKMUVGVRCPEV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|