C22H26F2N6O4S — CID 145288437
N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]propanamide;2,2-difluoro-1,3-dihydroinden-1-ol (PubChem CID 145288437) has the molecular formula C22H26F2N6O4S and a molecular weight of 508.55 g/mol. Its IUPAC name is N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]propanamide;2,2-difluoro-1,3-dihydroinden-1-ol.
| Compound Name | N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]propanamide;2,2-difluoro-1,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 145288437 |
| Molecular Formula | C22H26F2N6O4S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]propanamide;2,2-difluoro-1,3-dihydroinden-1-ol |
| SMILES | CCC(=O)NSOCC1CCC(n2cnc3c(N)ncnc32)O1.OC1c2ccccc2CC1(F)F |
| InChI | InChI=1S/C13H18N6O3S.C9H8F2O/c1-2-9(20)18-23-21-5-8-3-4-10(22-8)19-7-17-11-12(14)15-6-16-13(11)19;10-9(11)5-6-3-1-2-4-7(6)8(9)12/h6-8,10H,2-5H2,1H3,(H,18,20)(H2,14,15,16);1-4,8,12H,5H2 |
| InChIKey | RAFGCHLJEXLWRR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|