C20H23BN6O6S — CID 145288525
[2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanylamino]-4-oxobutanoyl]phenyl]boronic acid (PubChem CID 145288525) has the molecular formula C20H23BN6O6S and a molecular weight of 486.32 g/mol. Its IUPAC name is [2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanylamino]-4-oxobutanoyl]phenyl]boronic acid.
| Compound Name | [2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanylamino]-4-oxobutanoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 145288525 |
| Molecular Formula | C20H23BN6O6S |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanylamino]-4-oxobutanoyl]phenyl]boronic acid |
| SMILES | Nc1ncnc2c1ncn2C1CCC(COSNC(=O)CCC(=O)c2ccccc2B(O)O)O1 |
| InChI | InChI=1S/C20H23BN6O6S/c22-19-18-20(24-10-23-19)27(11-25-18)17-8-5-12(33-17)9-32-34-26-16(29)7-6-15(28)13-3-1-2-4-14(13)21(30)31/h1-4,10-12,17,30-31H,5-9H2,(H,26,29)(H2,22,23,24) |
| InChIKey | VTQXOBSXAHZWOC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|