C22H24N5O8P — CID 145288504
2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]oxy-4-oxobutanoyl]benzoic acid (PubChem CID 145288504) has the molecular formula C22H24N5O8P and a molecular weight of 517.44 g/mol. Its IUPAC name is 2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]oxy-4-oxobutanoyl]benzoic acid.
| Compound Name | 2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]oxy-4-oxobutanoyl]benzoic acid |
|---|---|
| PubChem CID | 145288504 |
| Molecular Formula | C22H24N5O8P |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-[4-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-methoxyphosphanyl]oxy-4-oxobutanoyl]benzoic acid |
| SMILES | COP(OCC1CCC(n2cnc3c(N)ncnc32)O1)OC(=O)CCC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C22H24N5O8P/c1-32-36(35-18(29)9-7-16(28)14-4-2-3-5-15(14)22(30)31)33-10-13-6-8-17(34-13)27-12-26-19-20(23)24-11-25-21(19)27/h2-5,11-13,17H,6-10H2,1H3,(H,30,31)(H2,23,24,25) |
| InChIKey | DCRIABJBBMMXMU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 177.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|