C21H22N5O11P — CID 130383141
2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-4-oxobutanoyl]benzoic acid (PubChem CID 130383141) has the molecular formula C21H22N5O11P and a molecular weight of 551.41 g/mol. Its IUPAC name is 2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-4-oxobutanoyl]benzoic acid.
| Compound Name | 2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-4-oxobutanoyl]benzoic acid |
|---|---|
| PubChem CID | 130383141 |
| Molecular Formula | C21H22N5O11P |
| Molecular Weight | 551.41 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | 2-[4-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-4-oxobutanoyl]benzoic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)CCC(=O)c2ccccc2C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22N5O11P/c22-18-15-19(24-8-23-18)26(9-25-15)20-17(30)16(29)13(36-20)7-35-38(33,34)37-14(28)6-5-12(27)10-3-1-2-4-11(10)21(31)32/h1-4,8-9,13,16-17,20,29-30H,5-7H2,(H,31,32)(H,33,34)(H2,22,23,24)/t13-,16-,17-,20-/m1/s1 |
| InChIKey | UPMSVGLZQNTSMC-AEVYOOLXSA-N |
| XLogP | 0.05 |
| TPSA | 246.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|