C18H19N6O12PS — CID 15957447
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] benzoylsulfamoyl carbonate (PubChem CID 15957447) has the molecular formula C18H19N6O12PS and a molecular weight of 574.42 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] benzoylsulfamoyl carbonate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] benzoylsulfamoyl carbonate |
|---|---|
| PubChem CID | 15957447 |
| Molecular Formula | C18H19N6O12PS |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] benzoylsulfamoyl carbonate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)OS(=O)(=O)NC(=O)c2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H19N6O12PS/c19-14-11-15(21-7-20-14)24(8-22-11)17-13(26)12(25)10(34-17)6-33-37(29,30)35-18(28)36-38(31,32)23-16(27)9-4-2-1-3-5-9/h1-5,7-8,10,12-13,17,25-26H,6H2,(H,23,27)(H,29,30)(H2,19,20,21)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | SIZACZGUSUVJEG-CNEMSGBDSA-N |
| XLogP | -1.03 |
| TPSA | 264.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|