C10H13N5NaO10PS — CID 56846220
sodium [[(2S,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] sulfate (PubChem CID 56846220) has the molecular formula C10H13N5NaO10PS and a molecular weight of 449.27 g/mol. Its IUPAC name is sodium [[(2S,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] sulfate.
| Compound Name | sodium [[(2S,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] sulfate |
|---|---|
| PubChem CID | 56846220 |
| Molecular Formula | C10H13N5NaO10PS |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | sodium [[(2S,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] sulfate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1O[C@@H](COP(=O)(O)OS(=O)(=O)[O-])[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C10H14N5O10PS.Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-26(18,19)25-27(20,21)22;/h2-4,6-7,10,16-17H,1H2,(H,18,19)(H2,11,12,13)(H,20,21,22);/q;+1/p-1/t4-,6-,7-,10-;/m0./s1 |
| InChIKey | JYPWXEPVDQGNMS-CDGWIDBKSA-M |
| XLogP | -5.37 |
| TPSA | 232.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|