C10H14KN5O10P2 — CID 23696311
potassium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate (PubChem CID 23696311) has the molecular formula C10H14KN5O10P2 and a molecular weight of 465.29 g/mol. Its IUPAC name is potassium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate.
| Compound Name | potassium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 23696311 |
| Molecular Formula | C10H14KN5O10P2 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | potassium [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)([O-])O)C(O)C1O.[K+] |
| InChI | InChI=1S/C10H15N5O10P2.K/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20;/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20);/q;+1/p-1 |
| InChIKey | ZNCWUOPIJTUALR-UHFFFAOYSA-M |
| XLogP | -5.37 |
| TPSA | 235.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|