C12H16N5O11PS — CID 165429823
2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-oxoethanesulfonic acid (PubChem CID 165429823) has the molecular formula C12H16N5O11PS and a molecular weight of 469.33 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 165429823 |
| Molecular Formula | C12H16N5O11PS |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-2-oxoethanesulfonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OC(=O)CS(=O)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N5O11PS/c13-10-7-11(15-3-14-10)17(4-16-7)12-9(20)8(19)5(27-12)1-26-29(21,22)28-6(18)2-30(23,24)25/h3-5,8-9,12,19-20H,1-2H2,(H,21,22)(H2,13,14,15)(H,23,24,25)/t5-,8-,9-,12-/m1/s1 |
| InChIKey | JYOVZZMANVQOLH-JJNLEZRASA-N |
| XLogP | -2.42 |
| TPSA | 246.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|