C24H33N6O5PS — CID 138613665
S-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-(benzylamino)phosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 138613665) has the molecular formula C24H33N6O5PS and a molecular weight of 548.61 g/mol. Its IUPAC name is S-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-(benzylamino)phosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-(benzylamino)phosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 138613665 |
| Molecular Formula | C24H33N6O5PS |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | S-[2-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-(benzylamino)phosphanyl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(NCc1ccccc1)OCC1CCC(n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C24H33N6O5PS/c1-24(2,14-31)23(32)37-11-10-33-36(29-12-17-6-4-3-5-7-17)34-13-18-8-9-19(35-18)30-16-28-20-21(25)26-15-27-22(20)30/h3-7,15-16,18-19,29,31H,8-14H2,1-2H3,(H2,25,26,27) |
| InChIKey | XWKCYDPLKNKNAV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|