C22H24F2N6O4S — CID 130383249
N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]-3-(2,2-difluoro-3-hydroxy-1,3-dihydroinden-1-yl)propanamide (PubChem CID 130383249) has the molecular formula C22H24F2N6O4S and a molecular weight of 506.54 g/mol. Its IUPAC name is N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]-3-(2,2-difluoro-3-hydroxy-1,3-dihydroinden-1-yl)propanamide.
| Compound Name | N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]-3-(2,2-difluoro-3-hydroxy-1,3-dihydroinden-1-yl)propanamide |
|---|---|
| PubChem CID | 130383249 |
| Molecular Formula | C22H24F2N6O4S |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | N-[[5-(6-aminopurin-9-yl)oxolan-2-yl]methoxysulfanyl]-3-(2,2-difluoro-3-hydroxy-1,3-dihydroinden-1-yl)propanamide |
| SMILES | Nc1ncnc2c1ncn2C1CCC(COSNC(=O)CCC2c3ccccc3C(O)C2(F)F)O1 |
| InChI | InChI=1S/C22H24F2N6O4S/c23-22(24)15(13-3-1-2-4-14(13)19(22)32)6-7-16(31)29-35-33-9-12-5-8-17(34-12)30-11-28-18-20(25)26-10-27-21(18)30/h1-4,10-12,15,17,19,32H,5-9H2,(H,29,31)(H2,25,26,27) |
| InChIKey | MLWOEIPEIZDYMZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|