C10H10FN5O — CID 57048358
9-[(2R)-4-fluoro-5-methylideneoxolan-2-yl]purin-6-amine (PubChem CID 57048358) has the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. Its IUPAC name is 9-[(2R)-4-fluoro-5-methylideneoxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R)-4-fluoro-5-methylideneoxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 57048358 |
| Molecular Formula | C10H10FN5O |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 9-[(2R)-4-fluoro-5-methylideneoxolan-2-yl]purin-6-amine |
| SMILES | C=C1O[C@@H](n2cnc3c(N)ncnc32)CC1F |
| InChI | InChI=1S/C10H10FN5O/c1-5-6(11)2-7(17-5)16-4-15-8-9(12)13-3-14-10(8)16/h3-4,6-7H,1-2H2,(H2,12,13,14)/t6?,7-/m1/s1 |
| InChIKey | YMNKORDCGLOVEH-COBSHVIPSA-N |
| XLogP | 1.18 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |