C16H14B2ClN2O7P — CID 171528930
CID 171528930 (PubChem CID 171528930) has the molecular formula C16H14B2ClN2O7P and a molecular weight of 434.35 g/mol.
| Compound Name | CID 171528930 |
|---|---|
| PubChem CID | 171528930 |
| Molecular Formula | C16H14B2ClN2O7P |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | — |
| SMILES | [B]C([B])(OP1(=O)OCc2ccccc2O1)C1CCC(n2cc(Cl)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C16H14B2ClN2O7P/c17-16(18,28-29(24)25-8-9-3-1-2-4-11(9)27-29)12-5-6-13(26-12)21-7-10(19)14(22)20-15(21)23/h1-4,7,12-13H,5-6,8H2,(H,20,22,23) |
| InChIKey | HRHFUPVGLBPSSK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|