C12H13B2N3O6 — CID 171528559
CID 171528559 (PubChem CID 171528559) has the molecular formula C12H13B2N3O6 and a molecular weight of 316.88 g/mol.
| Compound Name | CID 171528559 |
|---|---|
| PubChem CID | 171528559 |
| Molecular Formula | C12H13B2N3O6 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | — |
| SMILES | [B]C([B])(OC(=O)CN)C1CCC(n2cc(C=O)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C12H13B2N3O6/c13-12(14,23-9(19)3-15)7-1-2-8(22-7)17-4-6(5-18)10(20)16-11(17)21/h4-5,7-8H,1-3,15H2,(H,16,20,21) |
| InChIKey | OQLQEGVKPOLJQM-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 133.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|