C15H26BN3O7 — CID 153342302
CID 153342302 (PubChem CID 153342302) has the molecular formula C15H26BN3O7 and a molecular weight of 371.20 g/mol.
| Compound Name | CID 153342302 |
|---|---|
| PubChem CID | 153342302 |
| Molecular Formula | C15H26BN3O7 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | — |
| SMILES | CCC.CO.[B][C@@](O)(OC(=O)CN)C1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C11H14BN3O6.C3H8.CH4O/c12-11(19,21-9(17)5-13)6-1-2-8(20-6)15-4-3-7(16)14-10(15)18;1-3-2;1-2/h3-4,6,8,19H,1-2,5,13H2,(H,14,16,18);3H2,1-2H3;2H,1H3/t6?,8?,11-;;/m0../s1 |
| InChIKey | KNDRCRGXWAVFFR-QNWHIKICSA-N |
| XLogP | -1.44 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|