C16H16BFN2O8P+ — CID 171528782
CID 171528782 (PubChem CID 171528782) has the molecular formula C16H16BFN2O8P+ and a molecular weight of 425.09 g/mol.
| Compound Name | CID 171528782 |
|---|---|
| PubChem CID | 171528782 |
| Molecular Formula | C16H16BFN2O8P+ |
| Molecular Weight | 425.09 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O[P+]1(O)OCc2cc(F)ccc2O1)C1CCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C16H15BFN2O8P/c17-16(23,12-3-4-14(26-12)20-6-5-13(21)19-15(20)22)28-29(24)25-8-9-7-10(18)1-2-11(9)27-29/h1-2,5-7,12,14,23-24H,3-4,8H2/p+1 |
| InChIKey | CJIDVINGRNRDHY-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.09 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|