C17H18BClN2O8P+ — CID 153342190
CID 153342190 (PubChem CID 153342190) has the molecular formula C17H18BClN2O8P+ and a molecular weight of 455.58 g/mol.
| Compound Name | CID 153342190 |
|---|---|
| PubChem CID | 153342190 |
| Molecular Formula | C17H18BClN2O8P+ |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O[P+]1(O)OCc2cc(Cl)ccc2O1)C1CCC(n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C17H17BClN2O8P/c1-9-7-21(16(23)20-15(9)22)14-5-4-13(27-14)17(18,24)29-30(25)26-8-10-6-11(19)2-3-12(10)28-30/h2-3,6-7,13-14,24-25H,4-5,8H2,1H3/p+1 |
| InChIKey | IZRQDXTUJRBMAG-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|