C20H20B2ClN2O5PS — CID 171529083
CID 171529083 (PubChem CID 171529083) has the molecular formula C20H20B2ClN2O5PS and a molecular weight of 488.51 g/mol.
| Compound Name | CID 171529083 |
|---|---|
| PubChem CID | 171529083 |
| Molecular Formula | C20H20B2ClN2O5PS |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])(OP1OCc2cc(Cl)ccc2O1)C1CCC(n2cc(C#C)c(=S)[nH]c2=O)O1 |
| InChI | InChI=1S/C18H14B2ClN2O5PS.C2H6/c1-2-10-8-23(17(24)22-16(10)30)15-6-5-14(26-15)18(19,20)28-29-25-9-11-7-12(21)3-4-13(11)27-29;1-2/h1,3-4,7-8,14-15H,5-6,9H2,(H,22,24,30);1-2H3 |
| InChIKey | SLNQNISQYGVOCK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|