C19H17B2N2O6PS — CID 153342408
CID 153342408 (PubChem CID 153342408) has the molecular formula C19H17B2N2O6PS and a molecular weight of 454.02 g/mol.
| Compound Name | CID 153342408 |
|---|---|
| PubChem CID | 153342408 |
| Molecular Formula | C19H17B2N2O6PS |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | — |
| SMILES | [B]C([B])(OP1OCc2cccc(OC)c2O1)C1CCC(n2cc(C#C)c(=O)[nH]c2=S)O1 |
| InChI | InChI=1S/C19H17B2N2O6PS/c1-3-11-9-23(18(31)22-17(11)24)15-8-7-14(27-15)19(20,21)29-30-26-10-12-5-4-6-13(25-2)16(12)28-30/h1,4-6,9,14-15H,7-8,10H2,2H3,(H,22,24,31) |
| InChIKey | ZZTIUJPPIZUCRY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 83.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|