C11H10B2N2O3S — CID 156804258
CID 156804258 (PubChem CID 156804258) has the molecular formula C11H10B2N2O3S and a molecular weight of 271.90 g/mol.
| Compound Name | CID 156804258 |
|---|---|
| PubChem CID | 156804258 |
| Molecular Formula | C11H10B2N2O3S |
| Molecular Weight | 271.90 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C1CCC(n2cc(C#C)c(=O)[nH]c2=S)O1 |
| InChI | InChI=1S/C11H10B2N2O3S/c1-2-6-5-15(10(19)14-9(6)16)8-4-3-7(18-8)11(12,13)17/h1,5,7-8,17H,3-4H2,(H,14,16,19) |
| InChIKey | DKRORYLTZYYKRU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.90 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|