C21H31N2O8PS — CID 156804159
1-[5-[dihydroxy-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one;ethane;methanol (PubChem CID 156804159) has the molecular formula C21H31N2O8PS and a molecular weight of 502.53 g/mol. Its IUPAC name is 1-[5-[dihydroxy-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one;ethane;methanol.
| Compound Name | 1-[5-[dihydroxy-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one;ethane;methanol |
|---|---|
| PubChem CID | 156804159 |
| Molecular Formula | C21H31N2O8PS |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 1-[5-[dihydroxy-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one;ethane;methanol |
| SMILES | CC.CO.Cc1ccc2c(c1)COP(OC(O)(O)C1CCC(n3cc(C)c(=S)[nH]c3=O)O1)O2 |
| InChI | InChI=1S/C18H21N2O7PS.C2H6.CH4O/c1-10-3-4-13-12(7-10)9-24-28(26-13)27-18(22,23)14-5-6-15(25-14)20-8-11(2)16(29)19-17(20)21;2*1-2/h3-4,7-8,14-15,22-23H,5-6,9H2,1-2H3,(H,19,21,29);1-2H3;2H,1H3 |
| InChIKey | LBGHSOYXVRDWAU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|