C16H18BFN2O8P+ — CID 171528882
CID 171528882 (PubChem CID 171528882) has the molecular formula C16H18BFN2O8P+ and a molecular weight of 427.11 g/mol.
| Compound Name | CID 171528882 |
|---|---|
| PubChem CID | 171528882 |
| Molecular Formula | C16H18BFN2O8P+ |
| Molecular Weight | 427.11 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O[P+]1(O)OCc2cc(F)ccc2O1)C(CCn1ccc(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C16H17BFN2O8P/c1-25-13(4-6-20-7-5-14(21)19-15(20)22)16(17,23)28-29(24)26-9-10-8-11(18)2-3-12(10)27-29/h2-3,5,7-8,13,23-24H,4,6,9H2,1H3/p+1 |
| InChIKey | VQOSVOBMYLNDRF-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.11 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|