C24H31ClFN2O5PS — CID 156804328
5-chloro-1-[5-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 156804328) has the molecular formula C24H31ClFN2O5PS and a molecular weight of 545.01 g/mol. Its IUPAC name is 5-chloro-1-[5-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-chloro-1-[5-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 156804328 |
| Molecular Formula | C24H31ClFN2O5PS |
| Molecular Weight | 545.01 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 5-chloro-1-[5-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2c(c1F)COP(OCC1CCC(n3cc(Cl)c(=O)[nH]c3=S)O1)O2 |
| InChI | InChI=1S/C24H31ClFN2O5PS/c1-23(2,3)15-9-16(24(4,5)6)20-14(19(15)26)12-31-34(33-20)30-11-13-7-8-18(32-13)28-10-17(25)21(29)27-22(28)35/h9-10,13,18H,7-8,11-12H2,1-6H3,(H,27,29,35) |
| InChIKey | KNERSSYQBUSXDA-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.01 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|