C24H33F2N2O5PS — CID 156804264
1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-fluoro-4-sulfanylidenepyrimidin-2-one (PubChem CID 156804264) has the molecular formula C24H33F2N2O5PS and a molecular weight of 530.57 g/mol. Its IUPAC name is 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-fluoro-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-fluoro-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 156804264 |
| Molecular Formula | C24H33F2N2O5PS |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-3-methoxybutyl]-5-fluoro-4-sulfanylidenepyrimidin-2-one |
| SMILES | COC(CCn1cc(F)c(=S)[nH]c1=O)COP1OCc2c(F)c(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C24H33F2N2O5PS/c1-23(2,3)16-10-17(24(4,5)6)20-15(19(16)26)13-32-34(33-20)31-12-14(30-7)8-9-28-11-18(25)21(35)27-22(28)29/h10-11,14H,8-9,12-13H2,1-7H3,(H,27,29,35) |
| InChIKey | AGQISOJXFZCVHW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|