C17H21N2O6PS — CID 156804174
1-[4-(4H-1,3,2-benzodioxaphosphinin-2-yloxy)-3-methoxybutyl]-5-(hydroxymethyl)-4-sulfanylidenepyrimidin-2-one (PubChem CID 156804174) has the molecular formula C17H21N2O6PS and a molecular weight of 412.40 g/mol. Its IUPAC name is 1-[4-(4H-1,3,2-benzodioxaphosphinin-2-yloxy)-3-methoxybutyl]-5-(hydroxymethyl)-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-[4-(4H-1,3,2-benzodioxaphosphinin-2-yloxy)-3-methoxybutyl]-5-(hydroxymethyl)-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 156804174 |
| Molecular Formula | C17H21N2O6PS |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[4-(4H-1,3,2-benzodioxaphosphinin-2-yloxy)-3-methoxybutyl]-5-(hydroxymethyl)-4-sulfanylidenepyrimidin-2-one |
| SMILES | COC(CCn1cc(CO)c(=S)[nH]c1=O)COP1OCc2ccccc2O1 |
| InChI | InChI=1S/C17H21N2O6PS/c1-22-14(6-7-19-8-13(9-20)16(27)18-17(19)21)11-24-26-23-10-12-4-2-3-5-15(12)25-26/h2-5,8,14,20H,6-7,9-11H2,1H3,(H,18,21,27) |
| InChIKey | JQPOOATXXREKBR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|