C18H23B3N2O5PS — CID 156803986
CID 156803986 (PubChem CID 156803986) has the molecular formula C18H23B3N2O5PS and a molecular weight of 442.87 g/mol.
| Compound Name | CID 156803986 |
|---|---|
| PubChem CID | 156803986 |
| Molecular Formula | C18H23B3N2O5PS |
| Molecular Weight | 442.87 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | — |
| SMILES | [B]COP1OCc2cc(C)cc(C)c2O1.[B][C@H](CCn1ccc(=S)[nH]c1=O)O[B]C |
| InChI | InChI=1S/C10H12BO3P.C8H11B2N2O2S/c1-7-3-8(2)10-9(4-7)5-12-15(14-10)13-6-11;1-10-14-6(9)2-4-12-5-3-7(15)11-8(12)13/h3-4H,5-6H2,1-2H3;3,5-6H,2,4H2,1H3,(H,11,13,15)/t;6-/m.0/s1 |
| InChIKey | NWBCYIQZUFGDHC-ZCMDIHMWSA-N |
| XLogP | 3.06 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|