C18H22B3FN2O5PS — CID 156804377
CID 156804377 (PubChem CID 156804377) has the molecular formula C18H22B3FN2O5PS and a molecular weight of 460.86 g/mol.
| Compound Name | CID 156804377 |
|---|---|
| PubChem CID | 156804377 |
| Molecular Formula | C18H22B3FN2O5PS |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | — |
| SMILES | [B]COP1OCc2cc(C)cc(C)c2O1.[B][C@H](CCn1cc(F)c(=S)[nH]c1=O)O[B]C |
| InChI | InChI=1S/C10H12BO3P.C8H10B2FN2O2S/c1-7-3-8(2)10-9(4-7)5-12-15(14-10)13-6-11;1-10-15-6(9)2-3-13-4-5(11)7(16)12-8(13)14/h3-4H,5-6H2,1-2H3;4,6H,2-3H2,1H3,(H,12,14,16)/t;6-/m.0/s1 |
| InChIKey | ZLFHYEXMXNDZKB-ZCMDIHMWSA-N |
| XLogP | 3.20 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|