C24H33F2N2O8P — CID 156803862
1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 156803862) has the molecular formula C24H33F2N2O8P and a molecular weight of 546.50 g/mol. Its IUPAC name is 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 156803862 |
| Molecular Formula | C24H33F2N2O8P |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 1-[4-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4,4-dihydroxy-3-methoxybutyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | COC(CCn1cc(F)c(=O)[nH]c1=O)C(O)(O)OP1OCc2c(F)c(C(C)(C)C)cc(C(C)(C)C)c2O1 |
| InChI | InChI=1S/C24H33F2N2O8P/c1-22(2,3)14-10-15(23(4,5)6)19-13(18(14)26)12-34-37(35-19)36-24(31,32)17(33-7)8-9-28-11-16(25)20(29)27-21(28)30/h10-11,17,31-32H,8-9,12H2,1-7H3,(H,27,29,30) |
| InChIKey | KWLBZTOUTFLXHI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|