C20H24BN2O7P — CID 171529029
CID 171529029 (PubChem CID 171529029) has the molecular formula C20H24BN2O7P and a molecular weight of 446.21 g/mol.
| Compound Name | CID 171529029 |
|---|---|
| PubChem CID | 171529029 |
| Molecular Formula | C20H24BN2O7P |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c2c(c1)COP(OCO)O2.[B][C@H](CCn1cc(C#C)c(=O)[nH]c1=O)OC |
| InChI | InChI=1S/C10H11BN2O3.C10H13O4P/c1-3-7-6-13(5-4-8(11)16-2)10(15)12-9(7)14;1-7-3-8(2)10-9(4-7)5-12-15(14-10)13-6-11/h1,6,8H,4-5H2,2H3,(H,12,14,15);3-4,11H,5-6H2,1-2H3/t8-;/m0./s1 |
| InChIKey | YROYFBYEKZWHJM-QRPNPIFTSA-N |
| XLogP | 1.45 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|